CAS 336-14-1 is the registry number for 1,2-Dichlorodecafluorocyclohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
1,2-dichloro-1,2,3,3,4,4,5,5,6,6-decafluorocyclohexane (CAS 336-14-1) is a chemical compound with the molecular formula C6Cl2F10 and a molecular weight of 332.95 g/mol. IUPAC name: 1,2-dichloro-1,2,3,3,4,4,5,5,6,6-decafluorocyclohexane. InChIKey: IESCLXSTSQIECY-UHFFFAOYSA-N.
| Molecular formula | C6Cl2F10 |
|---|---|
| Molecular weight | 332.95 g/mol |
| IUPAC name | 1,2-dichloro-1,2,3,3,4,4,5,5,6,6-decafluorocyclohexane |
| InChIKey | IESCLXSTSQIECY-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1(F)F)(F)Cl)(F)Cl)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)