CAS 336-15-2 is the registry number for Chloroperfluorocyclohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-chloro-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane (CAS 336-15-2) is a chemical compound with the molecular formula C6ClF11 and a molecular weight of 316.50 g/mol. IUPAC name: 1-chloro-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane. InChIKey: KGZKBHYAEBRMAR-UHFFFAOYSA-N.
| Molecular formula | C6ClF11 |
|---|---|
| Molecular weight | 316.50 g/mol |
| IUPAC name | 1-chloro-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane |
| InChIKey | KGZKBHYAEBRMAR-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1(F)F)(F)F)(F)Cl)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)