CAS 336105-51-2 is the registry number for (2S)-1,1,1-Trifluoro-3,3-dimethylbutan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-amine;hydrochloride (CAS 336105-51-2) is a chemical compound with the molecular formula C6H13ClF3N and a molecular weight of 191.62 g/mol. IUPAC name: (2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-amine;hydrochloride. InChIKey: MXGSFTNYUNYRLZ-WCCKRBBISA-N.
| Molecular formula | C6H13ClF3N |
|---|---|
| Molecular weight | 191.62 g/mol |
| IUPAC name | (2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-amine;hydrochloride |
| InChIKey | MXGSFTNYUNYRLZ-WCCKRBBISA-N |
| SMILES | CC(C)(C)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)