Products 336180-49-5
CAS 336180-49-5 is the registry number for 2-(5-((4-Nitrobenzyl)thio)-1H-1,2,4-triazol-3-yl)phenol, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 100mg.
2-[3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]phenol (CAS 336180-49-5) is a chemical compound with the molecular formula C15H12N4O3S and a molecular weight of 328.3 g/mol. IUPAC name: 2-[3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]phenol. InChIKey: KMIIYKQCOKKASY-UHFFFAOYSA-N.
| Molecular formula | C15H12N4O3S |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 2-[3-[(4-nitrophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]phenol |
| InChIKey | KMIIYKQCOKKASY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NN2)SCC3=CC=C(C=C3)[N+](=O)[O-])O |
Computed by PubChem (NCBI)