CAS 3365-90-0 appears in our catalog under these names: 4,4'–Diamino–(1,1'–biphenyl)–3,3'–disulfonic acid, 4,4'-Diamino-[1,1'-biphenyl]-3,3'-disulfonic acid, 95%, 95%, 4,4'-Diamino-[1,1'-biphenyl]-3,3'-disulfonic acid, 95%, 4,4'-Diamino-[1,1'-biphenyl]-3,3'-disulfonic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g, 50g.
2-amino-5-(4-amino-3-sulfophenyl)benzenesulfonic acid (CAS 3365-90-0) is a chemical compound with the molecular formula C12H12N2O6S2 and a molecular weight of 344.4 g/mol. IUPAC name: 2-amino-5-(4-amino-3-sulfophenyl)benzenesulfonic acid. InChIKey: NFSOOPQRTBEFDR-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O6S2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-amino-5-(4-amino-3-sulfophenyl)benzenesulfonic acid |
| InChIKey | NFSOOPQRTBEFDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)N)S(=O)(=O)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)