CAS 336615-45-3 appears in our catalog under these names: Bis(2-bromobenzyl)amine hydrochloride, 95%, Bis(2-Bromobenzyl)Amine Hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100g, 25g, 5g, 10g.
1-(2-bromophenyl)-N-[(2-bromophenyl)methyl]methanamine;hydrochloride (CAS 336615-45-3) is a chemical compound with the molecular formula C14H14Br2ClN and a molecular weight of 391.53 g/mol. IUPAC name: 1-(2-bromophenyl)-N-[(2-bromophenyl)methyl]methanamine;hydrochloride. InChIKey: KXMULHDKALNZDJ-UHFFFAOYSA-N.
| Molecular formula | C14H14Br2ClN |
|---|---|
| Molecular weight | 391.53 g/mol |
| IUPAC name | 1-(2-bromophenyl)-N-[(2-bromophenyl)methyl]methanamine;hydrochloride |
| InChIKey | KXMULHDKALNZDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNCC2=CC=CC=C2Br)Br.Cl |
Computed by PubChem (NCBI)