Products 336615-64-6
CAS 336615-64-6 is the registry number for O-1269. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-pentylpyrazole-3-carboxamide (CAS 336615-64-6) is a chemical compound with the molecular formula C22H22Cl3N3O and a molecular weight of 450.8 g/mol. IUPAC name: 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-pentylpyrazole-3-carboxamide. InChIKey: JDBOTXIRNSWBCG-UHFFFAOYSA-N.
| Molecular formula | C22H22Cl3N3O |
|---|---|
| Molecular weight | 450.8 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-pentylpyrazole-3-carboxamide |
| InChIKey | JDBOTXIRNSWBCG-UHFFFAOYSA-N |
| SMILES | CCCCCNC(=O)C1=NN(C(=C1C)C2=CC=C(C=C2)Cl)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Amide derivative 1, orb2802410