CAS 33670-32-5 appears in our catalog under these names: (Methoxymethyl)triphenylphosphonium bromide, 98%, (Methoxymethyl)triphenylphosphonium bromide 95%, (Methoxymethyl)triphenylphosphonium bromide, 95%, 95%, (Methoxymethyl)triphenylphosphonium bromide, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 500g, 50g, 250g.
Methoxymethyl(triphenyl)phosphanium bromide (CAS 33670-32-5) is a chemical compound with the molecular formula C20H20BrOP and a molecular weight of 387.2 g/mol. IUPAC name: methoxymethyl(triphenyl)phosphanium bromide. InChIKey: NOCGROPYCGRERZ-UHFFFAOYSA-M.
| Molecular formula | C20H20BrOP |
|---|---|
| Molecular weight | 387.2 g/mol |
| IUPAC name | methoxymethyl(triphenyl)phosphanium bromide |
| InChIKey | NOCGROPYCGRERZ-UHFFFAOYSA-M |
| SMILES | COC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)