CAS 3370-27-2 is the registry number for 1,3-bis(1,1-Dimethylpropyl) benzene. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
1,3-bis(2-methylbutan-2-yl)benzene (CAS 3370-27-2) is a chemical compound with the molecular formula C16H26 and a molecular weight of 218.38 g/mol. IUPAC name: 1,3-bis(2-methylbutan-2-yl)benzene. InChIKey: VMFPJVIZINYTRD-UHFFFAOYSA-N.
| Molecular formula | C16H26 |
|---|---|
| Molecular weight | 218.38 g/mol |
| IUPAC name | 1,3-bis(2-methylbutan-2-yl)benzene |
| InChIKey | VMFPJVIZINYTRD-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=CC=C1)C(C)(C)CC |
Computed by PubChem (NCBI)