CAS 3370-69-2 is the registry number for 1-β-D-Arabinofuranosyl-5-bromo-2,4(1H,3H)-pyrimidinedione. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-bromo-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 3370-69-2) is a chemical compound with the molecular formula C9H11BrN2O6 and a molecular weight of 323.10 g/mol. IUPAC name: 5-bromo-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: AGFIRQJZCNVMCW-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O6 |
|---|---|
| Molecular weight | 323.10 g/mol |
| IUPAC name | 5-bromo-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | AGFIRQJZCNVMCW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)Br |
Computed by PubChem (NCBI)