CAS 3374-05-8 appears in our catalog under these names: Nalidixic acid sodium salt , Nalidixic acid sodium salt, Nalidixic acid sodium salt, 98.00%, Nalidixic acid (sodium salt), 99.83%, Nalidixic acid (sodium salt) (Standard). Offered by: Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Chemat, MedChemExpress, Roth. Available pack sizes: 5g, 25g, 100g, 1g, 250g, 500g, 50 mg, 100 mg.
Sodium 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (CAS 3374-05-8) is a chemical compound with the molecular formula C12H11N2NaO3 and a molecular weight of 254.22 g/mol. IUPAC name: sodium 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate. InChIKey: ROKRAUFZFDQWLE-UHFFFAOYSA-M.
| Molecular formula | C12H11N2NaO3 |
|---|---|
| Molecular weight | 254.22 g/mol |
| IUPAC name | sodium 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| InChIKey | ROKRAUFZFDQWLE-UHFFFAOYSA-M |
| SMILES | CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)