Products 33741-29-6
CAS 33741-29-6 is the registry number for (1S,2R,5S)-6,6-Dimethylbicyclo(3.1.1)heptane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,2R,5S)-6,6-dimethylbicyclo[3.1.1]heptane-2-carboxylic acid (CAS 33741-29-6) is a chemical compound with the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. IUPAC name: (1S,2R,5S)-6,6-dimethylbicyclo[3.1.1]heptane-2-carboxylic acid. InChIKey: FTWVTMKZNPJWOT-RNJXMRFFSA-N.
| Molecular formula | C10H16O2 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | (1S,2R,5S)-6,6-dimethylbicyclo[3.1.1]heptane-2-carboxylic acid |
| InChIKey | FTWVTMKZNPJWOT-RNJXMRFFSA-N |
| SMILES | CC1([C@H]2CC[C@H]([C@@H]1C2)C(=O)O)C |
Computed by PubChem (NCBI)