CAS 337487-69-1 appears in our catalog under these names: ([5-(2,4-Dichlorophenyl)-4-ethyl-4h-1,2,4-triazol-3-yl]thio)acetic acid, 95%, 2-{(5-(2,4-Dichlorophenyl)-4-ethyl-4H-1,2,4-triazol-3-yl)sulfanyl}acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-[[5-(2,4-dichlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 337487-69-1) is a chemical compound with the molecular formula C12H11Cl2N3O2S and a molecular weight of 332.2 g/mol. IUPAC name: 2-[[5-(2,4-dichlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: MMEQDLUEWRRHGK-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N3O2S |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 2-[[5-(2,4-dichlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | MMEQDLUEWRRHGK-UHFFFAOYSA-N |
| SMILES | CCN1C(=NN=C1SCC(=O)O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)