CAS 337496-62-5 is the registry number for Ethyl 4-((1,1'-biphenyl)-4-yl)-6-amino-5-cyano-2-methyl-4H-pyran-3-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 6-amino-5-cyano-2-methyl-4-(4-phenylphenyl)-4H-pyran-3-carboxylate (CAS 337496-62-5) is a chemical compound with the molecular formula C22H20N2O3 and a molecular weight of 360.4 g/mol. IUPAC name: ethyl 6-amino-5-cyano-2-methyl-4-(4-phenylphenyl)-4H-pyran-3-carboxylate. InChIKey: JAYPSSUHELJFKH-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O3 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | ethyl 6-amino-5-cyano-2-methyl-4-(4-phenylphenyl)-4H-pyran-3-carboxylate |
| InChIKey | JAYPSSUHELJFKH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=C(C1C2=CC=C(C=C2)C3=CC=CC=C3)C#N)N)C |
Computed by PubChem (NCBI)