CAS 33754-49-3 is the registry number for Zolazepam Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg.
4-(2-fluorophenyl)-1,3,8-trimethyl-6H-pyrazolo[5,4-e][1,4]diazepin-7-one;hydrochloride (CAS 33754-49-3) is a chemical compound with the molecular formula C15H16ClFN4O and a molecular weight of 322.76 g/mol. IUPAC name: 4-(2-fluorophenyl)-1,3,8-trimethyl-6H-pyrazolo[5,4-e][1,4]diazepin-7-one;hydrochloride. InChIKey: NJERAXSSDSHLGE-UHFFFAOYSA-N.
| Molecular formula | C15H16ClFN4O |
|---|---|
| Molecular weight | 322.76 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-1,3,8-trimethyl-6H-pyrazolo[5,4-e][1,4]diazepin-7-one;hydrochloride |
| InChIKey | NJERAXSSDSHLGE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=NCC(=O)N2C)C3=CC=CC=C3F)C.Cl |
Computed by PubChem (NCBI)