CAS 33758-12-2 is the registry number for Acetoacetyl-l-carnitine chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
[(2R)-3-carboxy-2-(3-oxobutanoyloxy)propyl]-trimethylazanium chloride (CAS 33758-12-2) is a chemical compound with the molecular formula C11H20ClNO5 and a molecular weight of 281.73 g/mol. IUPAC name: [(2R)-3-carboxy-2-(3-oxobutanoyloxy)propyl]-trimethylazanium chloride. InChIKey: NVZPBRZOMFSAAF-SBSPUUFOSA-N.
| Molecular formula | C11H20ClNO5 |
|---|---|
| Molecular weight | 281.73 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-(3-oxobutanoyloxy)propyl]-trimethylazanium chloride |
| InChIKey | NVZPBRZOMFSAAF-SBSPUUFOSA-N |
| SMILES | CC(=O)CC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)