CAS 3378-93-6 is the registry number for Clociguanil. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(3,4-dichlorophenyl)methoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine (CAS 3378-93-6) is a chemical compound with the molecular formula C12H15Cl2N5O and a molecular weight of 316.18 g/mol. IUPAC name: 1-[(3,4-dichlorophenyl)methoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine. InChIKey: XDTNOYLBDDCJSK-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N5O |
|---|---|
| Molecular weight | 316.18 g/mol |
| IUPAC name | 1-[(3,4-dichlorophenyl)methoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
| InChIKey | XDTNOYLBDDCJSK-UHFFFAOYSA-N |
| SMILES | CC1(N=C(N=C(N1OCC2=CC(=C(C=C2)Cl)Cl)N)N)C |
Computed by PubChem (NCBI)