CAS 33795-85-6 appears in our catalog under these names: 3,4,5,6–Tetrafluoro–N–methylphthalimide, 3,4,5,6-Tetrafluoro-N-methylphthalimide, 4,5,6,7-Tetrafluoro-2-methylisoindoline-1,3-dione 97%, 4,5,6,7-Tetrafluoro-2-methylisoindoline-1,3-dione, 98%, 98%, 4,5,6,7-Tetrafluoro-2-methylisoindoline-1,3-dione, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g, 2g, 10g, 50g, 100mg.
4,5,6,7-tetrafluoro-2-methylisoindole-1,3-dione (CAS 33795-85-6) is a chemical compound with the molecular formula C9H3F4NO2 and a molecular weight of 233.12 g/mol. IUPAC name: 4,5,6,7-tetrafluoro-2-methylisoindole-1,3-dione. InChIKey: AULXVJOTNZUFIY-UHFFFAOYSA-N.
| Molecular formula | C9H3F4NO2 |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 4,5,6,7-tetrafluoro-2-methylisoindole-1,3-dione |
| InChIKey | AULXVJOTNZUFIY-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C1=O)C(=C(C(=C2F)F)F)F |
Computed by PubChem (NCBI)