CAS 337970-22-6 is the registry number for 3-((S)-1-((R)-2,2-Dimethyl-1,3-dioxolan-4-yl)-2-hydroxyethoxy)propyl pivalate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
3-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]propyl 2,2-dimethylpropanoate (CAS 337970-22-6) is a chemical compound with the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. IUPAC name: 3-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]propyl 2,2-dimethylpropanoate. InChIKey: LXGZWBAPLPDLEP-NWDGAFQWSA-N.
| Molecular formula | C15H28O6 |
|---|---|
| Molecular weight | 304.38 g/mol |
| IUPAC name | 3-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]propyl 2,2-dimethylpropanoate |
| InChIKey | LXGZWBAPLPDLEP-NWDGAFQWSA-N |
| SMILES | CC1(OC[C@@H](O1)[C@H](CO)OCCCOC(=O)C(C)(C)C)C |
Computed by PubChem (NCBI)