CAS 3380-70-9 is the registry number for 1-(4-Methylphenyl)-2,3,4,9-tetrahydro-1h-beta-carboline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-(4-methylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (CAS 3380-70-9) is a chemical compound with the molecular formula C18H19ClN2 and a molecular weight of 298.8 g/mol. IUPAC name: 1-(4-methylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride. InChIKey: LGJLILSVJUIELV-UHFFFAOYSA-N.
| Molecular formula | C18H19ClN2 |
|---|---|
| Molecular weight | 298.8 g/mol |
| IUPAC name | 1-(4-methylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| InChIKey | LGJLILSVJUIELV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C3=C(CCN2)C4=CC=CC=C4N3.Cl |
Computed by PubChem (NCBI)