CAS 33818-21-2 is the registry number for 1,6-Anhydro-α-D-galactofuranose. Offered by: Chemat. Available pack sizes: 10mg, 1mg, 25mg, 2mg, 5mg.
(1R,4S,5R,6R,7R)-2,8-dioxabicyclo[3.2.1]octane-4,6,7-triol (CAS 33818-21-2) is a chemical compound with the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. IUPAC name: (1R,4S,5R,6R,7R)-2,8-dioxabicyclo[3.2.1]octane-4,6,7-triol. InChIKey: GYNYBVOAJFHCRG-YDMGZANHSA-N.
| Molecular formula | C6H10O5 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | (1R,4S,5R,6R,7R)-2,8-dioxabicyclo[3.2.1]octane-4,6,7-triol |
| InChIKey | GYNYBVOAJFHCRG-YDMGZANHSA-N |
| SMILES | C1[C@@H]([C@@H]2[C@@H]([C@H]([C@H](O1)O2)O)O)O |
Computed by PubChem (NCBI)