CAS 33830-10-3 appears in our catalog under these names: Amantadine-d15 (1-Amino Adamantane-d15), Amantadine-d15, Amantadine-d15 Hydrochloride, >95% (HPLC), 1-Adamantan-d15-amine, >95% (HPLC), Amantadine D15. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: on request, 10mg, 1mg, 0,05g, 0,01g, 1ml, 10 mg.
2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantan-1-amine (CAS 33830-10-3) is a chemical compound with the molecular formula C10H17N and a molecular weight of 166.34 g/mol. IUPAC name: 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantan-1-amine. InChIKey: DKNWSYNQZKUICI-BXSQCBKHSA-N.
| Molecular formula | C10H17N |
|---|---|
| Molecular weight | 166.34 g/mol |
| IUPAC name | 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantan-1-amine |
| InChIKey | DKNWSYNQZKUICI-BXSQCBKHSA-N |
| SMILES | [2H]C1(C2(C(C3(C(C1(C(C(C2([2H])[2H])(C3([2H])[2H])N)([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)