Products 33830-11-4
CAS 33830-11-4 appears in our catalog under these names: 1-Hydroxyadamantane-d15, 99 atom % D, min 98% Chemical Purity, 1-Adamantanol-d15. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5 mg, 1 mg.
2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantan-1-ol (CAS 33830-11-4) is a chemical compound with the molecular formula C10H16O and a molecular weight of 167.32 g/mol. IUPAC name: 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantan-1-ol. InChIKey: VLLNJDMHDJRNFK-BXSQCBKHSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 167.32 g/mol |
| IUPAC name | 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantan-1-ol |
| InChIKey | VLLNJDMHDJRNFK-BXSQCBKHSA-N |
| SMILES | [2H]C1(C2(C(C3(C(C1(C(C(C2([2H])[2H])(C3([2H])[2H])O)([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)