Products 33830-12-5
CAS 33830-12-5 appears in our catalog under these names: Adamantane-d15-carboxylic Acid, >95% (HPLC), Adamantane-d15-carboxylic Acid, 98 atom % D, min 98% Chemical Purity, Adamantane-carboxylic Acid-d15, 99%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 1 mg, 10 mg, 5 mg.
2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane-1-carboxylic acid (CAS 33830-12-5) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 195.33 g/mol. IUPAC name: 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane-1-carboxylic acid. InChIKey: JIMXXGFJRDUSRO-BXSQCBKHSA-N.
| Molecular formula | C11H16O2 |
|---|---|
| Molecular weight | 195.33 g/mol |
| IUPAC name | 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane-1-carboxylic acid |
| InChIKey | JIMXXGFJRDUSRO-BXSQCBKHSA-N |
| SMILES | [2H]C1(C2(C(C3(C(C1(C(C(C2([2H])[2H])(C3([2H])[2H])C(=O)O)([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)