CAS 338401-97-1 is the registry number for (3Z)-4-(Cyclohexylamino)-1,1,1-trifluoropent-3-en-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z)-4-(cyclohexylamino)-1,1,1-trifluoropent-3-en-2-one (CAS 338401-97-1) is a chemical compound with the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. IUPAC name: (Z)-4-(cyclohexylamino)-1,1,1-trifluoropent-3-en-2-one. InChIKey: GYESAFNKQXECCC-FPLPWBNLSA-N.
| Molecular formula | C11H16F3NO |
|---|---|
| Molecular weight | 235.25 g/mol |
| IUPAC name | (Z)-4-(cyclohexylamino)-1,1,1-trifluoropent-3-en-2-one |
| InChIKey | GYESAFNKQXECCC-FPLPWBNLSA-N |
| SMILES | C/C(=C/C(=O)C(F)(F)F)/NC1CCCCC1 |
Computed by PubChem (NCBI)