CAS 33851-23-9 appears in our catalog under these names: Methyl 7-chloro-3-hydroxybenzo[b]thiophene-2-carboxylate, 95%, Methyl 7–chloro–3–hydroxybenzo(b)thiophene–2–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
Methyl 7-chloro-3-hydroxy-1-benzothiophene-2-carboxylate (CAS 33851-23-9) is a chemical compound with the molecular formula C10H7ClO3S and a molecular weight of 242.68 g/mol. IUPAC name: methyl 7-chloro-3-hydroxy-1-benzothiophene-2-carboxylate. InChIKey: KSCCHUBNXONIII-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO3S |
|---|---|
| Molecular weight | 242.68 g/mol |
| IUPAC name | methyl 7-chloro-3-hydroxy-1-benzothiophene-2-carboxylate |
| InChIKey | KSCCHUBNXONIII-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C(=CC=C2)Cl)O |
Computed by PubChem (NCBI)