Products 33865-93-9
CAS 33865-93-9 is the registry number for 5-LOX/MAOs-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-methoxy-3-(5-methoxy-2,3-dihydro-1H-indol-2-yl)-1H-indole (CAS 33865-93-9) is a chemical compound with the molecular formula C18H18N2O2 and a molecular weight of 294.3 g/mol. IUPAC name: 5-methoxy-3-(5-methoxy-2,3-dihydro-1H-indol-2-yl)-1H-indole. InChIKey: JCIIGTWSSUKAHR-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O2 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 5-methoxy-3-(5-methoxy-2,3-dihydro-1H-indol-2-yl)-1H-indole |
| InChIKey | JCIIGTWSSUKAHR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(C2)C3=CNC4=C3C=C(C=C4)OC |
Computed by PubChem (NCBI)