CAS 33869-21-5 appears in our catalog under these names: 7-amino-2,8-bis(2,4-dihydroxyphenyl)phenoxazin-3-one, 95%, Lacmoid (C.I. 51400), 7-amino-2,8-bis(2,4-dihydroxyphenyl)phenoxazin-3-one. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100g, 250g, 25g, 5g, 1g, 10g.
7-amino-2,8-bis(2,4-dihydroxyphenyl)phenoxazin-3-one (CAS 33869-21-5) is a chemical compound with the molecular formula C24H16N2O6 and a molecular weight of 428.4 g/mol. IUPAC name: 7-amino-2,8-bis(2,4-dihydroxyphenyl)phenoxazin-3-one. InChIKey: ABNVFGQXCGFSFH-UHFFFAOYSA-N.
| Molecular formula | C24H16N2O6 |
|---|---|
| Molecular weight | 428.4 g/mol |
| IUPAC name | 7-amino-2,8-bis(2,4-dihydroxyphenyl)phenoxazin-3-one |
| InChIKey | ABNVFGQXCGFSFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C2=CC3=C(C=C2N)OC4=CC(=O)C(=CC4=N3)C5=C(C=C(C=C5)O)O |
Computed by PubChem (NCBI)