CAS 338736-46-2 appears in our catalog under these names: LY 456236, LY 456236 hydrochloride/ 99.89% (existing batch purity), LY 456236 hydrochloride, LY-456236, 6-Methoxy-N-(4-methoxyphenyl)quinazolin-4-amine hydrochloride, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
6-methoxy-N-(4-methoxyphenyl)quinazolin-4-amine;hydrochloride (CAS 338736-46-2) is a chemical compound with the molecular formula C16H16ClN3O2 and a molecular weight of 317.77 g/mol. IUPAC name: 6-methoxy-N-(4-methoxyphenyl)quinazolin-4-amine;hydrochloride. InChIKey: AVKFOWUSTVWZQN-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3O2 |
|---|---|
| Molecular weight | 317.77 g/mol |
| IUPAC name | 6-methoxy-N-(4-methoxyphenyl)quinazolin-4-amine;hydrochloride |
| InChIKey | AVKFOWUSTVWZQN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=NC=NC3=C2C=C(C=C3)OC.Cl |
Computed by PubChem (NCBI)