CAS 338770-95-9 is the registry number for 2–((4–Chlorobenzyl)amino)–1,1–bis(4–fluorophenyl)ethanol. Offered by: GLPBio. Available pack sizes: 1g.
2-[(4-chlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol (CAS 338770-95-9) is a chemical compound with the molecular formula C21H18ClF2NO and a molecular weight of 373.8 g/mol. IUPAC name: 2-[(4-chlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol. InChIKey: BYWPVERJPJMBAW-UHFFFAOYSA-N.
| Molecular formula | C21H18ClF2NO |
|---|---|
| Molecular weight | 373.8 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol |
| InChIKey | BYWPVERJPJMBAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNCC(C2=CC=C(C=C2)F)(C3=CC=C(C=C3)F)O)Cl |
Computed by PubChem (NCBI)