CAS 338771-37-2 is the registry number for 2–((2,4–Dichlorobenzyl)amino)–1,1–bis(4–fluorophenyl)ethanol. Offered by: GLPBio. Available pack sizes: 1g.
2-[(2,4-dichlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol (CAS 338771-37-2) is a chemical compound with the molecular formula C21H17Cl2F2NO and a molecular weight of 408.3 g/mol. IUPAC name: 2-[(2,4-dichlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol. InChIKey: QMTPFDCTDDBZNJ-UHFFFAOYSA-N.
| Molecular formula | C21H17Cl2F2NO |
|---|---|
| Molecular weight | 408.3 g/mol |
| IUPAC name | 2-[(2,4-dichlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol |
| InChIKey | QMTPFDCTDDBZNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CNCC2=C(C=C(C=C2)Cl)Cl)(C3=CC=C(C=C3)F)O)F |
Computed by PubChem (NCBI)