Products 338965-00-7
CAS 338965-00-7 is the registry number for N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-n'-methylacrylohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide (CAS 338965-00-7) is a chemical compound with the molecular formula C10H9ClF3N3O and a molecular weight of 279.64 g/mol. IUPAC name: N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide. InChIKey: DQIKQVXPIGLXOK-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3N3O |
|---|---|
| Molecular weight | 279.64 g/mol |
| IUPAC name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methylprop-2-enehydrazide |
| InChIKey | DQIKQVXPIGLXOK-UHFFFAOYSA-N |
| SMILES | CN(C1=C(C=C(C=N1)C(F)(F)F)Cl)NC(=O)C=C |
Computed by PubChem (NCBI)