CAS 338965-09-6 appears in our catalog under these names: Hepcidin antagonist-1/ 99.79% (existing batch purity), 5-(2,4-Dichlorobenzyl)-2-(2-pyridinyl)-4,6-pyrimidinediamine, Hepcidin antagonist-1, 98.07%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 10mg, 100mg, 50 mg, 10 mg.
5-[(2,4-dichlorophenyl)methyl]-2-pyridin-2-ylpyrimidine-4,6-diamine (CAS 338965-09-6) is a chemical compound with the molecular formula C16H13Cl2N5 and a molecular weight of 346.2 g/mol. IUPAC name: 5-[(2,4-dichlorophenyl)methyl]-2-pyridin-2-ylpyrimidine-4,6-diamine. InChIKey: LUGXKWLXOYRDIS-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2N5 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 5-[(2,4-dichlorophenyl)methyl]-2-pyridin-2-ylpyrimidine-4,6-diamine |
| InChIKey | LUGXKWLXOYRDIS-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=C(C(=N2)N)CC3=C(C=C(C=C3)Cl)Cl)N |
Computed by PubChem (NCBI)