CAS 339023-73-3 is the registry number for 4-(3-chloro-5-(trifluoromethyl)-2-pyridyloxy)benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzamide (CAS 339023-73-3) is a chemical compound with the molecular formula C13H8ClF3N2O2 and a molecular weight of 316.66 g/mol. IUPAC name: 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzamide. InChIKey: YUZFGWALNYDIAL-UHFFFAOYSA-N.
| Molecular formula | C13H8ClF3N2O2 |
|---|---|
| Molecular weight | 316.66 g/mol |
| IUPAC name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzamide |
| InChIKey | YUZFGWALNYDIAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)OC2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)