CAS 339056-48-3 appears in our catalog under these names: 4,5,6,7-Tetrahydro-1-benzothiophene-4-carboxylic acid, 95%, 4,5,6,7-Tetrahydro-1-benzothiophene-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,5,6,7-tetrahydro-1-benzothiophene-4-carboxylic acid (CAS 339056-48-3) is a chemical compound with the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1-benzothiophene-4-carboxylic acid. InChIKey: XGGAZRNXSISDNN-UHFFFAOYSA-N.
| Molecular formula | C9H10O2S |
|---|---|
| Molecular weight | 182.24 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1-benzothiophene-4-carboxylic acid |
| InChIKey | XGGAZRNXSISDNN-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)SC=C2)C(=O)O |
Computed by PubChem (NCBI)