CAS 339106-79-5 is the registry number for Methyl 2-(4-fluorophenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-(4-fluorophenyl)-1-oxoisoquinoline-4-carboxylate (CAS 339106-79-5) is a chemical compound with the molecular formula C17H12FNO3 and a molecular weight of 297.28 g/mol. IUPAC name: methyl 2-(4-fluorophenyl)-1-oxoisoquinoline-4-carboxylate. InChIKey: JFSOIMQHNZSTLP-UHFFFAOYSA-N.
| Molecular formula | C17H12FNO3 |
|---|---|
| Molecular weight | 297.28 g/mol |
| IUPAC name | methyl 2-(4-fluorophenyl)-1-oxoisoquinoline-4-carboxylate |
| InChIKey | JFSOIMQHNZSTLP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN(C(=O)C2=CC=CC=C21)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)