CAS 339107-28-7 is the registry number for N-(tert-Butyl)-4-(6-chloro-2-pyridinyl)tetrahydro-1(2h)-pyrazinecarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-tert-butyl-4-(6-chloro-2-pyridinyl)piperazine-1-carboxamide (CAS 339107-28-7) is a chemical compound with the molecular formula C14H21ClN4O and a molecular weight of 296.79 g/mol. IUPAC name: N-tert-butyl-4-(6-chloro-2-pyridinyl)piperazine-1-carboxamide. InChIKey: PWLDASOFIHLAQW-UHFFFAOYSA-N.
| Molecular formula | C14H21ClN4O |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | N-tert-butyl-4-(6-chloro-2-pyridinyl)piperazine-1-carboxamide |
| InChIKey | PWLDASOFIHLAQW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)N1CCN(CC1)C2=NC(=CC=C2)Cl |
Computed by PubChem (NCBI)