Products 339186-54-8
CAS 339186-54-8 appears in our catalog under these names: Bestatin–amido–Me, Bestatin-amido-Me. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
(2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-N,4-dimethylpentanamide (CAS 339186-54-8) is a chemical compound with the molecular formula C17H27N3O3 and a molecular weight of 321.4 g/mol. IUPAC name: (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-N,4-dimethylpentanamide. InChIKey: WXXGFNCJBKSHFH-ILXRZTDVSA-N.
| Molecular formula | C17H27N3O3 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-N,4-dimethylpentanamide |
| InChIKey | WXXGFNCJBKSHFH-ILXRZTDVSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NC)NC(=O)[C@H]([C@@H](CC1=CC=CC=C1)N)O |
Computed by PubChem (NCBI)