CAS 339191-82-1 is the registry number for Methyl 3-(4-nitrobenzenesulfonamido)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-[(4-nitrophenyl)sulfonylamino]propanoate (CAS 339191-82-1) is a chemical compound with the molecular formula C10H12N2O6S and a molecular weight of 288.28 g/mol. IUPAC name: methyl 3-[(4-nitrophenyl)sulfonylamino]propanoate. InChIKey: XAUMQBFXHCRFGM-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O6S |
|---|---|
| Molecular weight | 288.28 g/mol |
| IUPAC name | methyl 3-[(4-nitrophenyl)sulfonylamino]propanoate |
| InChIKey | XAUMQBFXHCRFGM-UHFFFAOYSA-N |
| SMILES | COC(=O)CCNS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)