Products 339231-67-3
CAS 339231-67-3 is the registry number for SCPI-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide (CAS 339231-67-3) is a chemical compound with the molecular formula C17H13Cl2N3OS and a molecular weight of 378.3 g/mol. IUPAC name: N-[4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide. InChIKey: XDFHOEGHGGFQKU-UHFFFAOYSA-N.
| Molecular formula | C17H13Cl2N3OS |
|---|---|
| Molecular weight | 378.3 g/mol |
| IUPAC name | N-[4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide |
| InChIKey | XDFHOEGHGGFQKU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)NC2=NC(=CS2)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)