CAS 33943-12-3 is the registry number for 2-Oxo-2,3-dihydro-1,3-benzoxazole-5-sulfonic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-oxo-3H-1,3-benzoxazole-5-sulfonic acid (CAS 33943-12-3) is a chemical compound with the molecular formula C7H5NO5S and a molecular weight of 215.19 g/mol. IUPAC name: 2-oxo-3H-1,3-benzoxazole-5-sulfonic acid. InChIKey: HBDZJQWRCAKVFC-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5S |
|---|---|
| Molecular weight | 215.19 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzoxazole-5-sulfonic acid |
| InChIKey | HBDZJQWRCAKVFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)O)NC(=O)O2 |
Computed by PubChem (NCBI)