Products 33945-50-5
CAS 33945-50-5 appears in our catalog under these names: Diacetamide-d7, 98 atom % D, min 95% Chemical Purity, Diacetamide-d7. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 5 mg, 2.5 mg.
N,2,2,2-tetradeuterio-N-(2,2,2-trideuterioacetyl)acetamide (CAS 33945-50-5) is a chemical compound with the molecular formula C4H7NO2 and a molecular weight of 108.15 g/mol. IUPAC name: N,2,2,2-tetradeuterio-N-(2,2,2-trideuterioacetyl)acetamide. InChIKey: ZSBDPRIWBYHIAF-KBKLHOFPSA-N.
| Molecular formula | C4H7NO2 |
|---|---|
| Molecular weight | 108.15 g/mol |
| IUPAC name | N,2,2,2-tetradeuterio-N-(2,2,2-trideuterioacetyl)acetamide |
| InChIKey | ZSBDPRIWBYHIAF-KBKLHOFPSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N([2H])C(=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)