Products 339527-79-6
CAS 339527-79-6 appears in our catalog under these names: DAR-4M Solution, DAR-4M, DAR-4M, 98.9%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg.
2-amino-6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-methyliminocyclohexa-1,4-diene-1-carboxylic acid (CAS 339527-79-6) is a chemical compound with the molecular formula C25H26N4O3 and a molecular weight of 430.5 g/mol. IUPAC name: 2-amino-6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-methyliminocyclohexa-1,4-diene-1-carboxylic acid. InChIKey: SEHXCXYNFKCWQY-UHFFFAOYSA-N.
| Molecular formula | C25H26N4O3 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 2-amino-6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-methyliminocyclohexa-1,4-diene-1-carboxylic acid |
| InChIKey | SEHXCXYNFKCWQY-UHFFFAOYSA-N |
| SMILES | CN=C1C=CC(=C2C3=C(C=C(C=C3)N(C)C)OC4=C2C=CC(=C4)N(C)C)C(=C1N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Diaminorhodamine-4M, orb2814078