CAS 3397-36-2 appears in our catalog under these names: Z-D-Phe-osu, 98%, Z–D–Phe–OSu, Z-D-Phe-OSu, Cbz-D-Phe-OSu 98%, Z-D-Phe-OSu, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
(2,5-dioxopyrrolidin-1-yl) (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (CAS 3397-36-2) is a chemical compound with the molecular formula C21H20N2O6 and a molecular weight of 396.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: MOJNKVWQJKPXCT-QGZVFWFLSA-N.
| Molecular formula | C21H20N2O6 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | MOJNKVWQJKPXCT-QGZVFWFLSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)