CAS 34004-14-3 appears in our catalog under these names: Methyl alpha-d-galactopyranoside monohydrate, 95%, Methyl α-D-galactopyranoside monohydrate, 98%, Methyl α–D–galactopyranoside monohydrate, 1-O-Methyl-alpha-D-galactopyranoside monohydrate, 1-O-Methyl-alpha-D-galactopyranoside monohydrate - Crude. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 25g, 100g, 500g, 5g, 500mg, 0,25kg, 2000g.
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;hydrate (CAS 34004-14-3) is a chemical compound with the molecular formula C7H16O7 and a molecular weight of 212.20 g/mol. IUPAC name: (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;hydrate. InChIKey: QFDRIBVAVJNJDT-SAPZPLNPSA-N.
| Molecular formula | C7H16O7 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;hydrate |
| InChIKey | QFDRIBVAVJNJDT-SAPZPLNPSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O.O |
Computed by PubChem (NCBI)