Products 340041-97-6
CAS 340041-97-6 is the registry number for p38 MAPK-IN-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyrimidin-7-amine (CAS 340041-97-6) is a chemical compound with the molecular formula C17H12FN5 and a molecular weight of 305.31 g/mol. IUPAC name: 2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyrimidin-7-amine. InChIKey: SXRLSMDAMBCWBT-UHFFFAOYSA-N.
| Molecular formula | C17H12FN5 |
|---|---|
| Molecular weight | 305.31 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-3-pyridin-4-ylimidazo[1,2-a]pyrimidin-7-amine |
| InChIKey | SXRLSMDAMBCWBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N3C=CC(=NC3=N2)N)C4=CC=NC=C4)F |
Computed by PubChem (NCBI)