Products 34006-32-1
CAS 34006-32-1 appears in our catalog under these names: Adiponitrile-d8, Hexanedinitrile-d8, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 10mg, 1g, 0,5g.
2,2,3,3,4,4,5,5-octadeuteriohexanedinitrile (CAS 34006-32-1) is a chemical compound with the molecular formula C6H8N2 and a molecular weight of 116.19 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octadeuteriohexanedinitrile. InChIKey: BTGRAWJCKBQKAO-SVYQBANQSA-N.
| Molecular formula | C6H8N2 |
|---|---|
| Molecular weight | 116.19 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octadeuteriohexanedinitrile |
| InChIKey | BTGRAWJCKBQKAO-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C#N)C([2H])([2H])C([2H])([2H])C([2H])([2H])C#N |
Computed by PubChem (NCBI)