CAS 34014-19-2 is the registry number for 1-(5-tert-Butyl-1,3,4-thiadiazol-2-yl)-1-ethyl-3-methylurea. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1-ethyl-3-methylurea (CAS 34014-19-2) is a chemical compound with the molecular formula C10H18N4OS and a molecular weight of 242.34 g/mol. IUPAC name: 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1-ethyl-3-methylurea. InChIKey: SXHBKICEQKVUJV-UHFFFAOYSA-N.
| Molecular formula | C10H18N4OS |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1-ethyl-3-methylurea |
| InChIKey | SXHBKICEQKVUJV-UHFFFAOYSA-N |
| SMILES | CCN(C1=NN=C(S1)C(C)(C)C)C(=O)NC |
Computed by PubChem (NCBI)