Products 340257-57-0
CAS 340257-57-0 appears in our catalog under these names: 1,3-Dimethoxybenzene-d10, 99 atom % D, min 98% Chemical Purity, Benzene–1，2，3，5–d4，4，6–di(methoxy–d3)–(9CI), 1,3-Dimethoxybenzene-d10, 98%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10mg, 100 mg, 5 mg, 10 mg, 50 mg, 25 mg.
1,1,2,2,3,3,4,5,5,6-decadeuterio-4,6-dimethoxycyclohexane (CAS 340257-57-0) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 154.27 g/mol. IUPAC name: 1,1,2,2,3,3,4,5,5,6-decadeuterio-4,6-dimethoxycyclohexane. InChIKey: MQTLTQMOALIWRO-UPEVGZBISA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 154.27 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,5,5,6-decadeuterio-4,6-dimethoxycyclohexane |
| InChIKey | MQTLTQMOALIWRO-UPEVGZBISA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])OC)([2H])[2H])([2H])OC)([2H])[2H])[2H] |
Computed by PubChem (NCBI)