CAS 340257-58-1 appears in our catalog under these names: Sodium Hexanoate-d11, 98 atom % D, min 98% Chemical Purity, N-Caproicacid-d11 (sodium). Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
Sodium 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate (CAS 340257-58-1) is a chemical compound with the molecular formula C6H11NaO2 and a molecular weight of 149.21 g/mol. IUPAC name: sodium 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate. InChIKey: UDWXLZLRRVQONG-PRPJRVKYSA-M.
| Molecular formula | C6H11NaO2 |
|---|---|
| Molecular weight | 149.21 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate |
| InChIKey | UDWXLZLRRVQONG-PRPJRVKYSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)